C18H26N2O4 — CID 91784644
1-[(3S,4S)-3-hydroxy-4-morpholin-4-ylpyrrolidin-1-yl]-4-phenoxybutan-1-one (PubChem CID 91784644) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is 1-[(3S,4S)-3-hydroxy-4-morpholin-4-ylpyrrolidin-1-yl]-4-phenoxybutan-1-one.
| Compound Name | 1-[(3S,4S)-3-hydroxy-4-morpholin-4-ylpyrrolidin-1-yl]-4-phenoxybutan-1-one |
|---|---|
| PubChem CID | 91784644 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 1-[(3S,4S)-3-hydroxy-4-morpholin-4-ylpyrrolidin-1-yl]-4-phenoxybutan-1-one |
| SMILES | O=C(CCCOc1ccccc1)N1C[C@H](O)[C@@H](N2CCOCC2)C1 |
| InChI | InChI=1S/C18H26N2O4/c21-17-14-20(13-16(17)19-8-11-23-12-9-19)18(22)7-4-10-24-15-5-2-1-3-6-15/h1-3,5-6,16-17,21H,4,7-14H2/t16-,17-/m0/s1 |
| InChIKey | LYEWHUWBQZUWCP-IRXDYDNUSA-N |
| XLogP | 0.75 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|