C23H20ClNO4 — CID 110165690
2-[(2-chlorophenyl)methyl-[3-(2-methoxyphenyl)benzoyl]amino]acetic acid (PubChem CID 110165690) has the molecular formula C23H20ClNO4 and a molecular weight of 409.87 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl-[3-(2-methoxyphenyl)benzoyl]amino]acetic acid.
| Compound Name | 2-[(2-chlorophenyl)methyl-[3-(2-methoxyphenyl)benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 110165690 |
| Molecular Formula | C23H20ClNO4 |
| Molecular Weight | 409.87 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl-[3-(2-methoxyphenyl)benzoyl]amino]acetic acid |
| SMILES | COc1ccccc1-c1cccc(C(=O)N(CC(=O)O)Cc2ccccc2Cl)c1 |
| InChI | InChI=1S/C23H20ClNO4/c1-29-21-12-5-3-10-19(21)16-8-6-9-17(13-16)23(28)25(15-22(26)27)14-18-7-2-4-11-20(18)24/h2-13H,14-15H2,1H3,(H,26,27) |
| InChIKey | JYXGEIIEJKHGMR-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.87 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |