C26H21ClN2O4 — CID 110165696
2-[(2-chlorophenyl)methyl-[2-(4-methoxyphenyl)quinoline-4-carbonyl]amino]acetic acid (PubChem CID 110165696) has the molecular formula C26H21ClN2O4 and a molecular weight of 460.92 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl-[2-(4-methoxyphenyl)quinoline-4-carbonyl]amino]acetic acid.
| Compound Name | 2-[(2-chlorophenyl)methyl-[2-(4-methoxyphenyl)quinoline-4-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 110165696 |
| Molecular Formula | C26H21ClN2O4 |
| Molecular Weight | 460.92 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl-[2-(4-methoxyphenyl)quinoline-4-carbonyl]amino]acetic acid |
| SMILES | COc1ccc(-c2cc(C(=O)N(CC(=O)O)Cc3ccccc3Cl)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C26H21ClN2O4/c1-33-19-12-10-17(11-13-19)24-14-21(20-7-3-5-9-23(20)28-24)26(32)29(16-25(30)31)15-18-6-2-4-8-22(18)27/h2-14H,15-16H2,1H3,(H,30,31) |
| InChIKey | ODHMSJQUDVULMP-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.92 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |