About 3-[[(2R,3R)-4-methyl-5-oxo-3-phenylmorpholine-2-carbonyl]-(2-phenylethyl)amino]propanoic acid
3-[[(2R,3R)-4-methyl-5-oxo-3-phenylmorpholine-2-carbonyl]-(2-phenylethyl)amino]propanoic acid (PubChem CID 110165774) has the molecular formula C23H26N2O5
and a molecular weight of 410.47 g/mol. Its IUPAC name is 3-[[(2R,3R)-4-methyl-5-oxo-3-phenylmorpholine-2-carbonyl]-(2-phenylethyl)amino]propanoic acid.
Molecular Properties
| Compound Name | 3-[[(2R,3R)-4-methyl-5-oxo-3-phenylmorpholine-2-carbonyl]-(2-phenylethyl)amino]propanoic acid |
| PubChem CID | 110165774 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 3-[[(2R,3R)-4-methyl-5-oxo-3-phenylmorpholine-2-carbonyl]-(2-phenylethyl)amino]propanoic acid |
| SMILES | CN1C(=O)CO[C@@H](C(=O)N(CCC(=O)O)CCc2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C23H26N2O5/c1-24-19(26)16-30-22(21(24)18-10-6-3-7-11-18)23(29)25(15-13-20(27)28)14-12-17-8-4-2-5-9-17/h2-11,21-22H,12-16H2,1H3,(H,27,28)/t21-,22-/m1/s1 |
| InChIKey | IVLFABWGWOEQJQ-FGZHOGPDSA-N |
| XLogP | 2.13 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[[(2R,3R)-4-methyl-5-oxo-3-phenylmorpholine-2-carbonyl]-(2-phenylethyl)amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(2R,3R)-4-methyl-5-oxo-3-phenylmorpholine-2-carbonyl]-(2-phenylethyl)amino]propanoic acid?
The IUPAC name of 3-[[(2R,3R)-4-methyl-5-oxo-3-phenylmorpholine-2-carbonyl]-(2-phenylethyl)amino]propanoic acid (CID 110165774) is 3-[[(2R,3R)-4-methyl-5-oxo-3-phenylmorpholine-2-carbonyl]-(2-phenylethyl)amino]propanoic acid.
What is the SMILES notation for 3-[[(2R,3R)-4-methyl-5-oxo-3-phenylmorpholine-2-carbonyl]-(2-phenylethyl)amino]propanoic acid?
The canonical SMILES for 3-[[(2R,3R)-4-methyl-5-oxo-3-phenylmorpholine-2-carbonyl]-(2-phenylethyl)amino]propanoic acid is CN1C(=O)CO[C@@H](C(=O)N(CCC(=O)O)CCc2ccccc2)[C@H]1c1ccccc1.
What is the InChIKey of 3-[[(2R,3R)-4-methyl-5-oxo-3-phenylmorpholine-2-carbonyl]-(2-phenylethyl)amino]propanoic acid?
The InChIKey is IVLFABWGWOEQJQ-FGZHOGPDSA-N. The full InChI is InChI=1S/C23H26N2O5/c1-24-19(26)16-30-22(21(24)18-10-6-3-7-11-18)23(29)25(15-13-20(27)28)14-12-17-8-4-2-5-9-17/h2-11,21-22H,12-16H2,1H3,(H,27,28)/t21-,22-/m1/s1.
What are the key properties of 3-[[(2R,3R)-4-methyl-5-oxo-3-phenylmorpholine-2-carbonyl]-(2-phenylethyl)amino]propanoic acid?
3-[[(2R,3R)-4-methyl-5-oxo-3-phenylmorpholine-2-carbonyl]-(2-phenylethyl)amino]propanoic acid has a molecular weight of 410.47 g/mol, XLogP of 2.13, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(2R,3R)-4-methyl-5-oxo-3-phenylmorpholine-2-carbonyl]-(2-phenylethyl)amino]propanoic acid is sourced from PubChem (CID 110165774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).