C27H38N2O3 — CID 110167409
2-[(3S,4S)-4-hydroxy-4-pentyl-3-phenoxypiperidin-1-yl]-N-(4-propan-2-ylphenyl)acetamide (PubChem CID 110167409) has the molecular formula C27H38N2O3 and a molecular weight of 438.61 g/mol. Its IUPAC name is 2-[(3S,4S)-4-hydroxy-4-pentyl-3-phenoxypiperidin-1-yl]-N-(4-propan-2-ylphenyl)acetamide.
| Compound Name | 2-[(3S,4S)-4-hydroxy-4-pentyl-3-phenoxypiperidin-1-yl]-N-(4-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 110167409 |
| Molecular Formula | C27H38N2O3 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.29 |
| IUPAC Name | 2-[(3S,4S)-4-hydroxy-4-pentyl-3-phenoxypiperidin-1-yl]-N-(4-propan-2-ylphenyl)acetamide |
| SMILES | CCCCC[C@]1(O)CCN(CC(=O)Nc2ccc(C(C)C)cc2)C[C@@H]1Oc1ccccc1 |
| InChI | InChI=1S/C27H38N2O3/c1-4-5-9-16-27(31)17-18-29(19-25(27)32-24-10-7-6-8-11-24)20-26(30)28-23-14-12-22(13-15-23)21(2)3/h6-8,10-15,21,25,31H,4-5,9,16-20H2,1-3H3,(H,28,30)/t25-,27-/m0/s1 |
| InChIKey | LCEPRHUSRANACX-BDYUSTAISA-N |
| XLogP | 5.21 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|