C25H31F3N2O3 — CID 110167420
2-[(3S,4S)-4-hydroxy-4-pentyl-3-phenoxypiperidin-1-yl]-N-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 110167420) has the molecular formula C25H31F3N2O3 and a molecular weight of 464.53 g/mol. Its IUPAC name is 2-[(3S,4S)-4-hydroxy-4-pentyl-3-phenoxypiperidin-1-yl]-N-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(3S,4S)-4-hydroxy-4-pentyl-3-phenoxypiperidin-1-yl]-N-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 110167420 |
| Molecular Formula | C25H31F3N2O3 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | 2-[(3S,4S)-4-hydroxy-4-pentyl-3-phenoxypiperidin-1-yl]-N-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | CCCCC[C@]1(O)CCN(CC(=O)Nc2ccc(C(F)(F)F)cc2)C[C@@H]1Oc1ccccc1 |
| InChI | InChI=1S/C25H31F3N2O3/c1-2-3-7-14-24(32)15-16-30(17-22(24)33-21-8-5-4-6-9-21)18-23(31)29-20-12-10-19(11-13-20)25(26,27)28/h4-6,8-13,22,32H,2-3,7,14-18H2,1H3,(H,29,31)/t22-,24-/m0/s1 |
| InChIKey | AAOPRQYTLRAXQW-UPVQGACJSA-N |
| XLogP | 5.11 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|