C28H34FN3O3S — CID 110167434
N-[4-(4-fluorophenyl)-5-methyl-1,3-thiazol-2-yl]-2-[(3S,4S)-4-hydroxy-4-pentyl-3-phenoxypiperidin-1-yl]acetamide (PubChem CID 110167434) has the molecular formula C28H34FN3O3S and a molecular weight of 511.66 g/mol. Its IUPAC name is N-[4-(4-fluorophenyl)-5-methyl-1,3-thiazol-2-yl]-2-[(3S,4S)-4-hydroxy-4-pentyl-3-phenoxypiperidin-1-yl]acetamide.
| Compound Name | N-[4-(4-fluorophenyl)-5-methyl-1,3-thiazol-2-yl]-2-[(3S,4S)-4-hydroxy-4-pentyl-3-phenoxypiperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 110167434 |
| Molecular Formula | C28H34FN3O3S |
| Molecular Weight | 511.66 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | N-[4-(4-fluorophenyl)-5-methyl-1,3-thiazol-2-yl]-2-[(3S,4S)-4-hydroxy-4-pentyl-3-phenoxypiperidin-1-yl]acetamide |
| SMILES | CCCCC[C@]1(O)CCN(CC(=O)Nc2nc(-c3ccc(F)cc3)c(C)s2)C[C@@H]1Oc1ccccc1 |
| InChI | InChI=1S/C28H34FN3O3S/c1-3-4-8-15-28(34)16-17-32(18-24(28)35-23-9-6-5-7-10-23)19-25(33)30-27-31-26(20(2)36-27)21-11-13-22(29)14-12-21/h5-7,9-14,24,34H,3-4,8,15-19H2,1-2H3,(H,30,31,33)/t24-,28-/m0/s1 |
| InChIKey | VNITVPWYLMSRHR-CUBQBAPOSA-N |
| XLogP | 5.66 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.66 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|