C16H16ClN3O3 — CID 110170097
ethyl 7-chloro-12-methoxy-3,5-dimethyl-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene-4-carboxylate (PubChem CID 110170097) has the molecular formula C16H16ClN3O3 and a molecular weight of 333.78 g/mol. Its IUPAC name is ethyl 7-chloro-12-methoxy-3,5-dimethyl-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene-4-carboxylate.
| Compound Name | ethyl 7-chloro-12-methoxy-3,5-dimethyl-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene-4-carboxylate |
|---|---|
| PubChem CID | 110170097 |
| Molecular Formula | C16H16ClN3O3 |
| Molecular Weight | 333.78 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | ethyl 7-chloro-12-methoxy-3,5-dimethyl-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene-4-carboxylate |
| SMILES | CCOC(=O)c1c(C)c2c(Cl)nc3ccc(OC)nc3n2c1C |
| InChI | InChI=1S/C16H16ClN3O3/c1-5-23-16(21)12-8(2)13-14(17)18-10-6-7-11(22-4)19-15(10)20(13)9(12)3/h6-7H,5H2,1-4H3 |
| InChIKey | FRJBQZVTKMYGSR-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.78 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |