C11H9ClN4O — CID 46831366
7-chloro-12-methoxy-5-methyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene (PubChem CID 46831366) has the molecular formula C11H9ClN4O and a molecular weight of 248.67 g/mol. Its IUPAC name is 7-chloro-12-methoxy-5-methyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene.
| Compound Name | 7-chloro-12-methoxy-5-methyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
|---|---|
| PubChem CID | 46831366 |
| Molecular Formula | C11H9ClN4O |
| Molecular Weight | 248.67 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 7-chloro-12-methoxy-5-methyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
| SMILES | COc1ccc2nc(Cl)c3c(C)ncn3c2n1 |
| InChI | InChI=1S/C11H9ClN4O/c1-6-9-10(12)14-7-3-4-8(17-2)15-11(7)16(9)5-13-6/h3-5H,1-2H3 |
| InChIKey | IYCLIAUGALGXEV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.67 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |