C18H12ClF3N4O — CID 86630790
7-chloro-12-methoxy-3-(2-methylphenyl)-5-(trifluoromethyl)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene (PubChem CID 86630790) has the molecular formula C18H12ClF3N4O and a molecular weight of 392.77 g/mol. Its IUPAC name is 7-chloro-12-methoxy-3-(2-methylphenyl)-5-(trifluoromethyl)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene.
| Compound Name | 7-chloro-12-methoxy-3-(2-methylphenyl)-5-(trifluoromethyl)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
|---|---|
| PubChem CID | 86630790 |
| Molecular Formula | C18H12ClF3N4O |
| Molecular Weight | 392.77 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 7-chloro-12-methoxy-3-(2-methylphenyl)-5-(trifluoromethyl)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
| SMILES | COc1ccc2nc(Cl)c3c(C(F)(F)F)nc(-c4ccccc4C)n3c2n1 |
| InChI | InChI=1S/C18H12ClF3N4O/c1-9-5-3-4-6-10(9)16-25-14(18(20,21)22)13-15(19)23-11-7-8-12(27-2)24-17(11)26(13)16/h3-8H,1-2H3 |
| InChIKey | BVDPAQLGKZSOKD-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.77 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |