C25H21FN4O — CID 68919274
12-[(4-fluorophenyl)methoxy]-5,7-dimethyl-3-(2-methylphenyl)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene (PubChem CID 68919274) has the molecular formula C25H21FN4O and a molecular weight of 412.47 g/mol. Its IUPAC name is 12-[(4-fluorophenyl)methoxy]-5,7-dimethyl-3-(2-methylphenyl)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene.
| Compound Name | 12-[(4-fluorophenyl)methoxy]-5,7-dimethyl-3-(2-methylphenyl)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
|---|---|
| PubChem CID | 68919274 |
| Molecular Formula | C25H21FN4O |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 12-[(4-fluorophenyl)methoxy]-5,7-dimethyl-3-(2-methylphenyl)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
| SMILES | Cc1ccccc1-c1nc(C)c2c(C)nc3ccc(OCc4ccc(F)cc4)nc3n12 |
| InChI | InChI=1S/C25H21FN4O/c1-15-6-4-5-7-20(15)24-28-17(3)23-16(2)27-21-12-13-22(29-25(21)30(23)24)31-14-18-8-10-19(26)11-9-18/h4-13H,14H2,1-3H3 |
| InChIKey | WVVLWNFHEQFMBQ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |