C21H20FN5O — CID 68868399
12-(cyclopropylmethoxy)-3-(6-fluoro-2-methyl-3-pyridinyl)-5,7-dimethyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene (PubChem CID 68868399) has the molecular formula C21H20FN5O and a molecular weight of 377.42 g/mol. Its IUPAC name is 12-(cyclopropylmethoxy)-3-(6-fluoro-2-methyl-3-pyridinyl)-5,7-dimethyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene.
| Compound Name | 12-(cyclopropylmethoxy)-3-(6-fluoro-2-methyl-3-pyridinyl)-5,7-dimethyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
|---|---|
| PubChem CID | 68868399 |
| Molecular Formula | C21H20FN5O |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 12-(cyclopropylmethoxy)-3-(6-fluoro-2-methyl-3-pyridinyl)-5,7-dimethyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
| SMILES | Cc1nc(F)ccc1-c1nc(C)c2c(C)nc3ccc(OCC4CC4)nc3n12 |
| InChI | InChI=1S/C21H20FN5O/c1-11-15(6-8-17(22)24-11)20-25-13(3)19-12(2)23-16-7-9-18(26-21(16)27(19)20)28-10-14-4-5-14/h6-9,14H,4-5,10H2,1-3H3 |
| InChIKey | VQFSCNVHMRPQLI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 65.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|