C16H11ClN4O — CID 110171513
6-chloro-3-(3-methoxyphenyl)-[1,2,4]triazolo[3,4-a]phthalazine (PubChem CID 110171513) has the molecular formula C16H11ClN4O and a molecular weight of 310.74 g/mol. Its IUPAC name is 6-chloro-3-(3-methoxyphenyl)-[1,2,4]triazolo[3,4-a]phthalazine.
| Compound Name | 6-chloro-3-(3-methoxyphenyl)-[1,2,4]triazolo[3,4-a]phthalazine |
|---|---|
| PubChem CID | 110171513 |
| Molecular Formula | C16H11ClN4O |
| Molecular Weight | 310.74 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 6-chloro-3-(3-methoxyphenyl)-[1,2,4]triazolo[3,4-a]phthalazine |
| SMILES | COc1cccc(-c2nnc3c4ccccc4c(Cl)nn23)c1 |
| InChI | InChI=1S/C16H11ClN4O/c1-22-11-6-4-5-10(9-11)15-18-19-16-13-8-3-2-7-12(13)14(17)20-21(15)16/h2-9H,1H3 |
| InChIKey | LSXAPZZEJZNBRH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.74 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |