C14H21N5O2S — CID 110175624
1,3-dimethyl-9-(3-methylsulfanylpropyl)-7,8-dihydro-6H-purino[7,8-a]pyrimidine-2,4-dione (PubChem CID 110175624) has the molecular formula C14H21N5O2S and a molecular weight of 323.42 g/mol. Its IUPAC name is 1,3-dimethyl-9-(3-methylsulfanylpropyl)-7,8-dihydro-6H-purino[7,8-a]pyrimidine-2,4-dione.
| Compound Name | 1,3-dimethyl-9-(3-methylsulfanylpropyl)-7,8-dihydro-6H-purino[7,8-a]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 110175624 |
| Molecular Formula | C14H21N5O2S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 1,3-dimethyl-9-(3-methylsulfanylpropyl)-7,8-dihydro-6H-purino[7,8-a]pyrimidine-2,4-dione |
| SMILES | CSCCCN1CCCn2c1nc1c2c(=O)n(C)c(=O)n1C |
| InChI | InChI=1S/C14H21N5O2S/c1-16-11-10(12(20)17(2)14(16)21)19-8-4-6-18(13(19)15-11)7-5-9-22-3/h4-9H2,1-3H3 |
| InChIKey | ILCYOWCFGKAUHW-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 65.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|