C15H23N5O3 — CID 110175634
10-(3-methoxypropyl)-1,3-dimethyl-6,7,8,9-tetrahydropurino[7,8-a][1,3]diazepine-2,4-dione (PubChem CID 110175634) has the molecular formula C15H23N5O3 and a molecular weight of 321.38 g/mol. Its IUPAC name is 10-(3-methoxypropyl)-1,3-dimethyl-6,7,8,9-tetrahydropurino[7,8-a][1,3]diazepine-2,4-dione.
| Compound Name | 10-(3-methoxypropyl)-1,3-dimethyl-6,7,8,9-tetrahydropurino[7,8-a][1,3]diazepine-2,4-dione |
|---|---|
| PubChem CID | 110175634 |
| Molecular Formula | C15H23N5O3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 10-(3-methoxypropyl)-1,3-dimethyl-6,7,8,9-tetrahydropurino[7,8-a][1,3]diazepine-2,4-dione |
| SMILES | COCCCN1CCCCn2c1nc1c2c(=O)n(C)c(=O)n1C |
| InChI | InChI=1S/C15H23N5O3/c1-17-12-11(13(21)18(2)15(17)22)20-9-5-4-7-19(14(20)16-12)8-6-10-23-3/h4-10H2,1-3H3 |
| InChIKey | VZQKDEKNRAZWOV-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 74.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|