C17H28Cl2N4O2 — CID 110176443
4-[3-[(6-chloro-2-pyridinyl)oxy]propyl]-N,N-diethylpiperazin-4-ium-1-carboxamide chloride (PubChem CID 110176443) has the molecular formula C17H28Cl2N4O2 and a molecular weight of 391.34 g/mol. Its IUPAC name is 4-[3-[(6-chloro-2-pyridinyl)oxy]propyl]-N,N-diethylpiperazin-4-ium-1-carboxamide chloride.
| Compound Name | 4-[3-[(6-chloro-2-pyridinyl)oxy]propyl]-N,N-diethylpiperazin-4-ium-1-carboxamide chloride |
|---|---|
| PubChem CID | 110176443 |
| Molecular Formula | C17H28Cl2N4O2 |
| Molecular Weight | 391.34 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 4-[3-[(6-chloro-2-pyridinyl)oxy]propyl]-N,N-diethylpiperazin-4-ium-1-carboxamide chloride |
| SMILES | CCN(CC)C(=O)N1CC[NH+](CCCOc2cccc(Cl)n2)CC1.[Cl-] |
| InChI | InChI=1S/C17H27ClN4O2.ClH/c1-3-21(4-2)17(23)22-12-10-20(11-13-22)9-6-14-24-16-8-5-7-15(18)19-16;/h5,7-8H,3-4,6,9-14H2,1-2H3;1H |
| InChIKey | YGTYUCIXAHKZTM-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 50.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.34 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|