C14H21Cl2N3O2 — CID 110185953
1-(6-chloro-2-pyridinyl)-4-[2-(1,3-dioxolan-2-yl)ethyl]piperazin-4-ium chloride (PubChem CID 110185953) has the molecular formula C14H21Cl2N3O2 and a molecular weight of 334.25 g/mol. Its IUPAC name is 1-(6-chloro-2-pyridinyl)-4-[2-(1,3-dioxolan-2-yl)ethyl]piperazin-4-ium chloride.
| Compound Name | 1-(6-chloro-2-pyridinyl)-4-[2-(1,3-dioxolan-2-yl)ethyl]piperazin-4-ium chloride |
|---|---|
| PubChem CID | 110185953 |
| Molecular Formula | C14H21Cl2N3O2 |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 1-(6-chloro-2-pyridinyl)-4-[2-(1,3-dioxolan-2-yl)ethyl]piperazin-4-ium chloride |
| SMILES | Clc1cccc(N2CC[NH+](CCC3OCCO3)CC2)n1.[Cl-] |
| InChI | InChI=1S/C14H20ClN3O2.ClH/c15-12-2-1-3-13(16-12)18-8-6-17(7-9-18)5-4-14-19-10-11-20-14;/h1-3,14H,4-11H2;1H |
| InChIKey | DYNHCGZLIVHIOC-UHFFFAOYSA-N |
| XLogP | -2.79 |
| TPSA | 39.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | -2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|