C17H22N6O — CID 110178200
N-[2-[(5-amino-2-pyridinyl)amino]phenyl]-4-methylpiperazine-1-carboxamide (PubChem CID 110178200) has the molecular formula C17H22N6O and a molecular weight of 326.40 g/mol. Its IUPAC name is N-[2-[(5-amino-2-pyridinyl)amino]phenyl]-4-methylpiperazine-1-carboxamide.
| Compound Name | N-[2-[(5-amino-2-pyridinyl)amino]phenyl]-4-methylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 110178200 |
| Molecular Formula | C17H22N6O |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | N-[2-[(5-amino-2-pyridinyl)amino]phenyl]-4-methylpiperazine-1-carboxamide |
| SMILES | CN1CCN(C(=O)Nc2ccccc2Nc2ccc(N)cn2)CC1 |
| InChI | InChI=1S/C17H22N6O/c1-22-8-10-23(11-9-22)17(24)21-15-5-3-2-4-14(15)20-16-7-6-13(18)12-19-16/h2-7,12H,8-11,18H2,1H3,(H,19,20)(H,21,24) |
| InChIKey | HJTOGTXBLHMCAD-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_NH_no_alk_A(1)', 'substructure': 'N/A'} |
|---|