C24H28N4O5 — CID 70406277
(Z)-but-2-enedioic acid;N-[2-(2,3-dihydroindol-1-yl)phenyl]-4-methylpiperazine-1-carboxamide (PubChem CID 70406277) has the molecular formula C24H28N4O5 and a molecular weight of 452.51 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;N-[2-(2,3-dihydroindol-1-yl)phenyl]-4-methylpiperazine-1-carboxamide.
| Compound Name | (Z)-but-2-enedioic acid;N-[2-(2,3-dihydroindol-1-yl)phenyl]-4-methylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 70406277 |
| Molecular Formula | C24H28N4O5 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | (Z)-but-2-enedioic acid;N-[2-(2,3-dihydroindol-1-yl)phenyl]-4-methylpiperazine-1-carboxamide |
| SMILES | CN1CCN(C(=O)Nc2ccccc2N2CCc3ccccc32)CC1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C20H24N4O.C4H4O4/c1-22-12-14-23(15-13-22)20(25)21-17-7-3-5-9-19(17)24-11-10-16-6-2-4-8-18(16)24;5-3(6)1-2-4(7)8/h2-9H,10-15H2,1H3,(H,21,25);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | BQFHDWFKSIKXTK-BTJKTKAUSA-N |
| XLogP | 2.87 |
| TPSA | 113.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|