C26H32ClN3O — CID 110179060
N-(6-anilino-3-pyridinyl)-2-chloro-2-(3,5,7-trimethyl-1-adamantyl)acetamide (PubChem CID 110179060) has the molecular formula C26H32ClN3O and a molecular weight of 438.02 g/mol. Its IUPAC name is N-(6-anilino-3-pyridinyl)-2-chloro-2-(3,5,7-trimethyl-1-adamantyl)acetamide.
| Compound Name | N-(6-anilino-3-pyridinyl)-2-chloro-2-(3,5,7-trimethyl-1-adamantyl)acetamide |
|---|---|
| PubChem CID | 110179060 |
| Molecular Formula | C26H32ClN3O |
| Molecular Weight | 438.02 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | N-(6-anilino-3-pyridinyl)-2-chloro-2-(3,5,7-trimethyl-1-adamantyl)acetamide |
| SMILES | CC12CC3(C)CC(C)(C1)CC(C(Cl)C(=O)Nc1ccc(Nc4ccccc4)nc1)(C2)C3 |
| InChI | InChI=1S/C26H32ClN3O/c1-23-12-24(2)14-25(3,13-23)17-26(15-23,16-24)21(27)22(31)30-19-9-10-20(28-11-19)29-18-7-5-4-6-8-18/h4-11,21H,12-17H2,1-3H3,(H,28,29)(H,30,31) |
| InChIKey | ISQYIPJSLWCBEF-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.02 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|