C20H35NO7S — CID 110180528
3-carboxy-3,5-dihydroxy-5-oxopentanoate;2-(3,7-dimethylocta-1,6-dien-3-ylsulfanyl)ethyl-dimethylazanium (PubChem CID 110180528) has the molecular formula C20H35NO7S and a molecular weight of 433.57 g/mol. Its IUPAC name is 3-carboxy-3,5-dihydroxy-5-oxopentanoate;2-(3,7-dimethylocta-1,6-dien-3-ylsulfanyl)ethyl-dimethylazanium.
| Compound Name | 3-carboxy-3,5-dihydroxy-5-oxopentanoate;2-(3,7-dimethylocta-1,6-dien-3-ylsulfanyl)ethyl-dimethylazanium |
|---|---|
| PubChem CID | 110180528 |
| Molecular Formula | C20H35NO7S |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | 3-carboxy-3,5-dihydroxy-5-oxopentanoate;2-(3,7-dimethylocta-1,6-dien-3-ylsulfanyl)ethyl-dimethylazanium |
| SMILES | C=CC(C)(CCC=C(C)C)SCC[NH+](C)C.O=C([O-])CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C14H27NS.C6H8O7/c1-7-14(4,10-8-9-13(2)3)16-12-11-15(5)6;7-3(8)1-6(13,5(11)12)2-4(9)10/h7,9H,1,8,10-12H2,2-6H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | OKBZLVQUAHEXGO-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 139.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|