C14H27NS — CID 110180529
2-(3,7-dimethylocta-1,6-dien-3-ylsulfanyl)-N,N-dimethylethanamine (PubChem CID 110180529) has the molecular formula C14H27NS and a molecular weight of 241.44 g/mol. Its IUPAC name is 2-(3,7-dimethylocta-1,6-dien-3-ylsulfanyl)-N,N-dimethylethanamine.
| Compound Name | 2-(3,7-dimethylocta-1,6-dien-3-ylsulfanyl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 110180529 |
| Molecular Formula | C14H27NS |
| Molecular Weight | 241.44 g/mol |
| Exact Mass | 241.19 |
| IUPAC Name | 2-(3,7-dimethylocta-1,6-dien-3-ylsulfanyl)-N,N-dimethylethanamine |
| SMILES | C=CC(C)(CCC=C(C)C)SCCN(C)C |
| InChI | InChI=1S/C14H27NS/c1-7-14(4,10-8-9-13(2)3)16-12-11-15(5)6/h7,9H,1,8,10-12H2,2-6H3 |
| InChIKey | YZTLWAIRULFAEZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|