C23H28N2O2S2 — CID 110181822
4-[4-(2-methoxyphenyl)piperazin-1-yl]-1,1-di(thiophen-3-yl)butan-1-ol (PubChem CID 110181822) has the molecular formula C23H28N2O2S2 and a molecular weight of 428.62 g/mol. Its IUPAC name is 4-[4-(2-methoxyphenyl)piperazin-1-yl]-1,1-di(thiophen-3-yl)butan-1-ol.
| Compound Name | 4-[4-(2-methoxyphenyl)piperazin-1-yl]-1,1-di(thiophen-3-yl)butan-1-ol |
|---|---|
| PubChem CID | 110181822 |
| Molecular Formula | C23H28N2O2S2 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 4-[4-(2-methoxyphenyl)piperazin-1-yl]-1,1-di(thiophen-3-yl)butan-1-ol |
| SMILES | COc1ccccc1N1CCN(CCCC(O)(c2ccsc2)c2ccsc2)CC1 |
| InChI | InChI=1S/C23H28N2O2S2/c1-27-22-6-3-2-5-21(22)25-13-11-24(12-14-25)10-4-9-23(26,19-7-15-28-17-19)20-8-16-29-18-20/h2-3,5-8,15-18,26H,4,9-14H2,1H3 |
| InChIKey | ZETXEBWVMVKAOF-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |