C22H25N3O2S2 — CID 110182379
N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethoxy]-1,1-di(thiophen-3-yl)methanimine (PubChem CID 110182379) has the molecular formula C22H25N3O2S2 and a molecular weight of 427.60 g/mol. Its IUPAC name is N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethoxy]-1,1-di(thiophen-3-yl)methanimine.
| Compound Name | N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethoxy]-1,1-di(thiophen-3-yl)methanimine |
|---|---|
| PubChem CID | 110182379 |
| Molecular Formula | C22H25N3O2S2 |
| Molecular Weight | 427.60 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethoxy]-1,1-di(thiophen-3-yl)methanimine |
| SMILES | COc1ccc(N2CCN(CCON=C(c3ccsc3)c3ccsc3)CC2)cc1 |
| InChI | InChI=1S/C22H25N3O2S2/c1-26-21-4-2-20(3-5-21)25-10-8-24(9-11-25)12-13-27-23-22(18-6-14-28-16-18)19-7-15-29-17-19/h2-7,14-17H,8-13H2,1H3 |
| InChIKey | BNWCVSWNMYYOLH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 37.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.60 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|