C18H26N2S3 — CID 110184824
2-[1,3-bis(methylsulfanyl)propan-2-yl]-1-butyl-5-phenylimidazole-4-thiol (PubChem CID 110184824) has the molecular formula C18H26N2S3 and a molecular weight of 366.62 g/mol. Its IUPAC name is 2-[1,3-bis(methylsulfanyl)propan-2-yl]-1-butyl-5-phenylimidazole-4-thiol.
| Compound Name | 2-[1,3-bis(methylsulfanyl)propan-2-yl]-1-butyl-5-phenylimidazole-4-thiol |
|---|---|
| PubChem CID | 110184824 |
| Molecular Formula | C18H26N2S3 |
| Molecular Weight | 366.62 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 2-[1,3-bis(methylsulfanyl)propan-2-yl]-1-butyl-5-phenylimidazole-4-thiol |
| SMILES | CCCCn1c(C(CSC)CSC)nc(S)c1-c1ccccc1 |
| InChI | InChI=1S/C18H26N2S3/c1-4-5-11-20-16(14-9-7-6-8-10-14)18(21)19-17(20)15(12-22-2)13-23-3/h6-10,15,21H,4-5,11-13H2,1-3H3 |
| InChIKey | MXCQAZPYICRDRD-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 17.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.62 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|