C17H28N2O2 — CID 110185847
3-cyclohexyl-N-[5-(2,2-dimethylpropyl)-1,2-oxazol-3-yl]propanamide (PubChem CID 110185847) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is 3-cyclohexyl-N-[5-(2,2-dimethylpropyl)-1,2-oxazol-3-yl]propanamide.
| Compound Name | 3-cyclohexyl-N-[5-(2,2-dimethylpropyl)-1,2-oxazol-3-yl]propanamide |
|---|---|
| PubChem CID | 110185847 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 3-cyclohexyl-N-[5-(2,2-dimethylpropyl)-1,2-oxazol-3-yl]propanamide |
| SMILES | CC(C)(C)Cc1cc(NC(=O)CCC2CCCCC2)no1 |
| InChI | InChI=1S/C17H28N2O2/c1-17(2,3)12-14-11-15(19-21-14)18-16(20)10-9-13-7-5-4-6-8-13/h11,13H,4-10,12H2,1-3H3,(H,18,19,20) |
| InChIKey | MIBXTOGDEHAXSF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |