C11H13ClN4O4 — CID 110187665
3-(3-methoxy-4-nitrophenyl)-4-methyl-4,5-dihydro-1H-1,2,4-triazin-4-ium-6-one chloride (PubChem CID 110187665) has the molecular formula C11H13ClN4O4 and a molecular weight of 300.70 g/mol. Its IUPAC name is 3-(3-methoxy-4-nitrophenyl)-4-methyl-4,5-dihydro-1H-1,2,4-triazin-4-ium-6-one chloride.
| Compound Name | 3-(3-methoxy-4-nitrophenyl)-4-methyl-4,5-dihydro-1H-1,2,4-triazin-4-ium-6-one chloride |
|---|---|
| PubChem CID | 110187665 |
| Molecular Formula | C11H13ClN4O4 |
| Molecular Weight | 300.70 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 3-(3-methoxy-4-nitrophenyl)-4-methyl-4,5-dihydro-1H-1,2,4-triazin-4-ium-6-one chloride |
| SMILES | COc1cc(C2=NNC(=O)C[NH+]2C)ccc1[N+](=O)[O-].[Cl-] |
| InChI | InChI=1S/C11H12N4O4.ClH/c1-14-6-10(16)12-13-11(14)7-3-4-8(15(17)18)9(5-7)19-2;/h3-5H,6H2,1-2H3,(H,12,16);1H |
| InChIKey | PMTRBBGHSRFKTC-UHFFFAOYSA-N |
| XLogP | -4.09 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.70 |
| LogP ≤ 5 | -4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|