C6H9NO2 — CID 11018881
(2S,3Z)-2-aminohexa-3,5-dienoic acid (PubChem CID 11018881) has the molecular formula C6H9NO2 and a molecular weight of 127.14 g/mol. Its IUPAC name is (2S,3Z)-2-aminohexa-3,5-dienoic acid.
| Compound Name | (2S,3Z)-2-aminohexa-3,5-dienoic acid |
|---|---|
| PubChem CID | 11018881 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | (2S,3Z)-2-aminohexa-3,5-dienoic acid |
| SMILES | C=C/C=C\[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H9NO2/c1-2-3-4-5(7)6(8)9/h2-5H,1,7H2,(H,8,9)/b4-3-/t5-/m0/s1 |
| InChIKey | LAVTULVXLBWEBX-XUELKZDXSA-N |
| XLogP | 0.14 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|