C7H9O2- — CID 22754991
(3E)-2-methylhexa-3,5-dienoate (PubChem CID 22754991) has the molecular formula C7H9O2- and a molecular weight of 125.15 g/mol. Its IUPAC name is (3E)-2-methylhexa-3,5-dienoate.
| Compound Name | (3E)-2-methylhexa-3,5-dienoate |
|---|---|
| PubChem CID | 22754991 |
| Molecular Formula | C7H9O2- |
| Molecular Weight | 125.15 g/mol |
| Exact Mass | 125.06 |
| IUPAC Name | (3E)-2-methylhexa-3,5-dienoate |
| SMILES | C=C/C=C/C(C)C(=O)[O-] |
| InChI | InChI=1S/C7H10O2/c1-3-4-5-6(2)7(8)9/h3-6H,1H2,2H3,(H,8,9)/p-1/b5-4+ |
| InChIKey | BFNAVDGAMZHSKZ-SNAWJCMRSA-M |
| XLogP | 0.11 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.15 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|