About N'-[(3Z)-hexa-3,5-dien-2-yl]prop-2-enehydrazide
N'-[(3Z)-hexa-3,5-dien-2-yl]prop-2-enehydrazide (PubChem CID 155302110) has the molecular formula C9H14N2O
and a molecular weight of 166.22 g/mol. Its IUPAC name is N'-[(3Z)-hexa-3,5-dien-2-yl]prop-2-enehydrazide.
Molecular Properties
| Compound Name | N'-[(3Z)-hexa-3,5-dien-2-yl]prop-2-enehydrazide |
| PubChem CID | 155302110 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | N'-[(3Z)-hexa-3,5-dien-2-yl]prop-2-enehydrazide |
| SMILES | C=C/C=C\C(C)NNC(=O)C=C |
| InChI | InChI=1S/C9H14N2O/c1-4-6-7-8(3)10-11-9(12)5-2/h4-8,10H,1-2H2,3H3,(H,11,12)/b7-6- |
| InChIKey | NMONIKPRSGHFQD-SREVYHEPSA-N |
| XLogP | 0.92 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N'-[(3Z)-hexa-3,5-dien-2-yl]prop-2-enehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(3Z)-hexa-3,5-dien-2-yl]prop-2-enehydrazide?
The IUPAC name of N'-[(3Z)-hexa-3,5-dien-2-yl]prop-2-enehydrazide (CID 155302110) is N'-[(3Z)-hexa-3,5-dien-2-yl]prop-2-enehydrazide.
What is the SMILES notation for N'-[(3Z)-hexa-3,5-dien-2-yl]prop-2-enehydrazide?
The canonical SMILES for N'-[(3Z)-hexa-3,5-dien-2-yl]prop-2-enehydrazide is C=C/C=C\C(C)NNC(=O)C=C.
What is the InChIKey of N'-[(3Z)-hexa-3,5-dien-2-yl]prop-2-enehydrazide?
The InChIKey is NMONIKPRSGHFQD-SREVYHEPSA-N. The full InChI is InChI=1S/C9H14N2O/c1-4-6-7-8(3)10-11-9(12)5-2/h4-8,10H,1-2H2,3H3,(H,11,12)/b7-6-.
What are the key properties of N'-[(3Z)-hexa-3,5-dien-2-yl]prop-2-enehydrazide?
N'-[(3Z)-hexa-3,5-dien-2-yl]prop-2-enehydrazide has a molecular weight of 166.22 g/mol, XLogP of 0.92, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(3Z)-hexa-3,5-dien-2-yl]prop-2-enehydrazide is sourced from PubChem (CID 155302110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).