C16H21N5O2S2 — CID 110189538
1-[[2-[[5-methyl-4-(2-methylsulfanylethyl)-1H-imidazol-2-yl]sulfanyl]acetyl]amino]-3-phenylurea (PubChem CID 110189538) has the molecular formula C16H21N5O2S2 and a molecular weight of 379.51 g/mol. Its IUPAC name is 1-[[2-[[5-methyl-4-(2-methylsulfanylethyl)-1H-imidazol-2-yl]sulfanyl]acetyl]amino]-3-phenylurea.
| Compound Name | 1-[[2-[[5-methyl-4-(2-methylsulfanylethyl)-1H-imidazol-2-yl]sulfanyl]acetyl]amino]-3-phenylurea |
|---|---|
| PubChem CID | 110189538 |
| Molecular Formula | C16H21N5O2S2 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 1-[[2-[[5-methyl-4-(2-methylsulfanylethyl)-1H-imidazol-2-yl]sulfanyl]acetyl]amino]-3-phenylurea |
| SMILES | CSCCc1nc(SCC(=O)NNC(=O)Nc2ccccc2)[nH]c1C |
| InChI | InChI=1S/C16H21N5O2S2/c1-11-13(8-9-24-2)19-16(17-11)25-10-14(22)20-21-15(23)18-12-6-4-3-5-7-12/h3-7H,8-10H2,1-2H3,(H,17,19)(H,20,22)(H2,18,21,23) |
| InChIKey | REQMKRHKHFMBLM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 98.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|