C16H16N5O2S+ — CID 3647540
1-[[2-(1H-benzimidazol-3-ium-2-ylsulfanyl)acetyl]amino]-3-phenylurea (PubChem CID 3647540) has the molecular formula C16H16N5O2S+ and a molecular weight of 342.40 g/mol. Its IUPAC name is 1-[[2-(1H-benzimidazol-3-ium-2-ylsulfanyl)acetyl]amino]-3-phenylurea.
| Compound Name | 1-[[2-(1H-benzimidazol-3-ium-2-ylsulfanyl)acetyl]amino]-3-phenylurea |
|---|---|
| PubChem CID | 3647540 |
| Molecular Formula | C16H16N5O2S+ |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 1-[[2-(1H-benzimidazol-3-ium-2-ylsulfanyl)acetyl]amino]-3-phenylurea |
| SMILES | O=C(CSc1[nH]c2ccccc2[nH+]1)NNC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C16H15N5O2S/c22-14(20-21-15(23)17-11-6-2-1-3-7-11)10-24-16-18-12-8-4-5-9-13(12)19-16/h1-9H,10H2,(H,18,19)(H,20,22)(H2,17,21,23)/p+1 |
| InChIKey | YYQZRNYBVKWQBF-UHFFFAOYSA-O |
| XLogP | 1.93 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|