C16H16N5OS+ — CID 5174082
2-(1H-benzimidazol-3-ium-2-ylsulfanyl)-N'-(1-pyridin-3-ylethenyl)acetohydrazide (PubChem CID 5174082) has the molecular formula C16H16N5OS+ and a molecular weight of 326.41 g/mol. Its IUPAC name is 2-(1H-benzimidazol-3-ium-2-ylsulfanyl)-N'-(1-pyridin-3-ylethenyl)acetohydrazide.
| Compound Name | 2-(1H-benzimidazol-3-ium-2-ylsulfanyl)-N'-(1-pyridin-3-ylethenyl)acetohydrazide |
|---|---|
| PubChem CID | 5174082 |
| Molecular Formula | C16H16N5OS+ |
| Molecular Weight | 326.41 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 2-(1H-benzimidazol-3-ium-2-ylsulfanyl)-N'-(1-pyridin-3-ylethenyl)acetohydrazide |
| SMILES | C=C(NNC(=O)CSc1[nH]c2ccccc2[nH+]1)c1cccnc1 |
| InChI | InChI=1S/C16H15N5OS/c1-11(12-5-4-8-17-9-12)20-21-15(22)10-23-16-18-13-6-2-3-7-14(13)19-16/h2-9,20H,1,10H2,(H,18,19)(H,21,22)/p+1 |
| InChIKey | BSOGJIVJPKKVLW-UHFFFAOYSA-O |
| XLogP | 1.76 |
| TPSA | 83.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.41 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|