C16H17N3O2S — CID 26641197
N'-[2-(2,5-dimethylphenyl)sulfanylacetyl]pyridine-3-carbohydrazide (PubChem CID 26641197) has the molecular formula C16H17N3O2S and a molecular weight of 315.40 g/mol. Its IUPAC name is N'-[2-(2,5-dimethylphenyl)sulfanylacetyl]pyridine-3-carbohydrazide.
| Compound Name | N'-[2-(2,5-dimethylphenyl)sulfanylacetyl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 26641197 |
| Molecular Formula | C16H17N3O2S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | N'-[2-(2,5-dimethylphenyl)sulfanylacetyl]pyridine-3-carbohydrazide |
| SMILES | Cc1ccc(C)c(SCC(=O)NNC(=O)c2cccnc2)c1 |
| InChI | InChI=1S/C16H17N3O2S/c1-11-5-6-12(2)14(8-11)22-10-15(20)18-19-16(21)13-4-3-7-17-9-13/h3-9H,10H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | GLNWFVYIEARBQC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|