C14H14Cl2N8 — CID 110190045
4-N-(3,5-dichlorophenyl)-2-N-propan-2-yl-6-(1,2,4-triazol-1-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 110190045) has the molecular formula C14H14Cl2N8 and a molecular weight of 365.23 g/mol. Its IUPAC name is 4-N-(3,5-dichlorophenyl)-2-N-propan-2-yl-6-(1,2,4-triazol-1-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-(3,5-dichlorophenyl)-2-N-propan-2-yl-6-(1,2,4-triazol-1-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 110190045 |
| Molecular Formula | C14H14Cl2N8 |
| Molecular Weight | 365.23 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 4-N-(3,5-dichlorophenyl)-2-N-propan-2-yl-6-(1,2,4-triazol-1-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC(C)Nc1nc(Nc2cc(Cl)cc(Cl)c2)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C14H14Cl2N8/c1-8(2)19-12-21-13(20-11-4-9(15)3-10(16)5-11)23-14(22-12)24-7-17-6-18-24/h3-8H,1-2H3,(H2,19,20,21,22,23) |
| InChIKey | UYJWXOAYNJCCDJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.23 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |