C21H13ClF2N2O — CID 110192765
4-[(4-chlorophenyl)methyl]-2-(2,4-difluorophenyl)phthalazin-1-one (PubChem CID 110192765) has the molecular formula C21H13ClF2N2O and a molecular weight of 382.80 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methyl]-2-(2,4-difluorophenyl)phthalazin-1-one.
| Compound Name | 4-[(4-chlorophenyl)methyl]-2-(2,4-difluorophenyl)phthalazin-1-one |
|---|---|
| PubChem CID | 110192765 |
| Molecular Formula | C21H13ClF2N2O |
| Molecular Weight | 382.80 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 4-[(4-chlorophenyl)methyl]-2-(2,4-difluorophenyl)phthalazin-1-one |
| SMILES | O=c1c2ccccc2c(Cc2ccc(Cl)cc2)nn1-c1ccc(F)cc1F |
| InChI | InChI=1S/C21H13ClF2N2O/c22-14-7-5-13(6-8-14)11-19-16-3-1-2-4-17(16)21(27)26(25-19)20-10-9-15(23)12-18(20)24/h1-10,12H,11H2 |
| InChIKey | DGAQVPFOFPKMLP-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.80 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |