C26H24FN5O2 — CID 110194461
ethyl 2-[3-[[3-cyano-6-(4-fluorophenyl)-2-pyridinyl]amino]propyl]-1-methylbenzimidazole-5-carboxylate (PubChem CID 110194461) has the molecular formula C26H24FN5O2 and a molecular weight of 457.51 g/mol. Its IUPAC name is ethyl 2-[3-[[3-cyano-6-(4-fluorophenyl)-2-pyridinyl]amino]propyl]-1-methylbenzimidazole-5-carboxylate.
| Compound Name | ethyl 2-[3-[[3-cyano-6-(4-fluorophenyl)-2-pyridinyl]amino]propyl]-1-methylbenzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 110194461 |
| Molecular Formula | C26H24FN5O2 |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | ethyl 2-[3-[[3-cyano-6-(4-fluorophenyl)-2-pyridinyl]amino]propyl]-1-methylbenzimidazole-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)nc(CCCNc1nc(-c3ccc(F)cc3)ccc1C#N)n2C |
| InChI | InChI=1S/C26H24FN5O2/c1-3-34-26(33)18-9-13-23-22(15-18)30-24(32(23)2)5-4-14-29-25-19(16-28)8-12-21(31-25)17-6-10-20(27)11-7-17/h6-13,15H,3-5,14H2,1-2H3,(H,29,31) |
| InChIKey | KIGIMJFTNOFIQC-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|