C10H9NOS — CID 11019693
5-deuterio-3-phenylmethoxy-1,2-thiazole (PubChem CID 11019693) has the molecular formula C10H9NOS and a molecular weight of 192.26 g/mol. Its IUPAC name is 5-deuterio-3-phenylmethoxy-1,2-thiazole.
| Compound Name | 5-deuterio-3-phenylmethoxy-1,2-thiazole |
|---|---|
| PubChem CID | 11019693 |
| Molecular Formula | C10H9NOS |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 5-deuterio-3-phenylmethoxy-1,2-thiazole |
| SMILES | [2H]c1cc(OCc2ccccc2)ns1 |
| InChI | InChI=1S/C10H9NOS/c1-2-4-9(5-3-1)8-12-10-6-7-13-11-10/h1-7H,8H2/i7D |
| InChIKey | AIQQNUUPCJHSNJ-WHRKIXHSSA-N |
| XLogP | 2.72 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |