C21H26N4O4S — CID 110197656
4-(6-methoxyspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-piperidine]-1'-yl)sulfonyl-3,5-dimethyl-1,2-oxazole (PubChem CID 110197656) has the molecular formula C21H26N4O4S and a molecular weight of 430.53 g/mol. Its IUPAC name is 4-(6-methoxyspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-piperidine]-1'-yl)sulfonyl-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-(6-methoxyspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-piperidine]-1'-yl)sulfonyl-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 110197656 |
| Molecular Formula | C21H26N4O4S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 4-(6-methoxyspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-piperidine]-1'-yl)sulfonyl-3,5-dimethyl-1,2-oxazole |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCNC31CCN(S(=O)(=O)c2c(C)noc2C)CC1 |
| InChI | InChI=1S/C21H26N4O4S/c1-13-19(14(2)29-24-13)30(26,27)25-10-7-21(8-11-25)20-16(6-9-22-21)17-12-15(28-3)4-5-18(17)23-20/h4-5,12,22-23H,6-11H2,1-3H3 |
| InChIKey | UOCJGZRRFKYJQG-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |