C18H27N3O — CID 110199309
(1S,11R)-2-(pyridin-3-ylmethyl)-2,9-diazabicyclo[9.3.0]tetradecan-10-one (PubChem CID 110199309) has the molecular formula C18H27N3O and a molecular weight of 301.43 g/mol. Its IUPAC name is (1S,11R)-2-(pyridin-3-ylmethyl)-2,9-diazabicyclo[9.3.0]tetradecan-10-one.
| Compound Name | (1S,11R)-2-(pyridin-3-ylmethyl)-2,9-diazabicyclo[9.3.0]tetradecan-10-one |
|---|---|
| PubChem CID | 110199309 |
| Molecular Formula | C18H27N3O |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.22 |
| IUPAC Name | (1S,11R)-2-(pyridin-3-ylmethyl)-2,9-diazabicyclo[9.3.0]tetradecan-10-one |
| SMILES | O=C1NCCCCCCN(Cc2cccnc2)[C@H]2CCC[C@@H]12 |
| InChI | InChI=1S/C18H27N3O/c22-18-16-8-5-9-17(16)21(12-4-2-1-3-11-20-18)14-15-7-6-10-19-13-15/h6-7,10,13,16-17H,1-5,8-9,11-12,14H2,(H,20,22)/t16-,17+/m1/s1 |
| InChIKey | RUBWDWXXVKGWBD-SJORKVTESA-N |
| XLogP | 2.74 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |