C15H17N3O3 — CID 110200973
4-(7-oxo-1,4,8-oxadiazecane-4-carbonyl)benzonitrile (PubChem CID 110200973) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is 4-(7-oxo-1,4,8-oxadiazecane-4-carbonyl)benzonitrile.
| Compound Name | 4-(7-oxo-1,4,8-oxadiazecane-4-carbonyl)benzonitrile |
|---|---|
| PubChem CID | 110200973 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 4-(7-oxo-1,4,8-oxadiazecane-4-carbonyl)benzonitrile |
| SMILES | N#Cc1ccc(C(=O)N2CCOCCNC(=O)CC2)cc1 |
| InChI | InChI=1S/C15H17N3O3/c16-11-12-1-3-13(4-2-12)15(20)18-7-5-14(19)17-6-9-21-10-8-18/h1-4H,5-10H2,(H,17,19) |
| InChIKey | JRGCOQJCEKSXSA-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |