C17H19N3O3 — CID 110200979
8-(isoquinoline-1-carbonyl)-1,4,8-oxadiazecan-5-one (PubChem CID 110200979) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is 8-(isoquinoline-1-carbonyl)-1,4,8-oxadiazecan-5-one.
| Compound Name | 8-(isoquinoline-1-carbonyl)-1,4,8-oxadiazecan-5-one |
|---|---|
| PubChem CID | 110200979 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 8-(isoquinoline-1-carbonyl)-1,4,8-oxadiazecan-5-one |
| SMILES | O=C1CCN(C(=O)c2nccc3ccccc23)CCOCCN1 |
| InChI | InChI=1S/C17H19N3O3/c21-15-6-9-20(10-12-23-11-8-18-15)17(22)16-14-4-2-1-3-13(14)5-7-19-16/h1-5,7H,6,8-12H2,(H,18,21) |
| InChIKey | KGCAJGOMARMQKC-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |