C17H20F3NO3 — CID 110203454
(4-hydroxy-1-oxa-9-azaspiro[5.5]undecan-9-yl)-[4-(trifluoromethyl)phenyl]methanone (PubChem CID 110203454) has the molecular formula C17H20F3NO3 and a molecular weight of 343.34 g/mol. Its IUPAC name is (4-hydroxy-1-oxa-9-azaspiro[5.5]undecan-9-yl)-[4-(trifluoromethyl)phenyl]methanone.
| Compound Name | (4-hydroxy-1-oxa-9-azaspiro[5.5]undecan-9-yl)-[4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 110203454 |
| Molecular Formula | C17H20F3NO3 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | (4-hydroxy-1-oxa-9-azaspiro[5.5]undecan-9-yl)-[4-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1ccc(C(F)(F)F)cc1)N1CCC2(CC1)CC(O)CCO2 |
| InChI | InChI=1S/C17H20F3NO3/c18-17(19,20)13-3-1-12(2-4-13)15(23)21-8-6-16(7-9-21)11-14(22)5-10-24-16/h1-4,14,22H,5-11H2 |
| InChIKey | ADLFNBBPBNOQMS-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |