C33H43N3O8 — CID 110206737
1-[6-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]hexanoyl]piperidine-4-carboxylic acid (PubChem CID 110206737) has the molecular formula C33H43N3O8 and a molecular weight of 609.72 g/mol. Its IUPAC name is 1-[6-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]hexanoyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[6-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]hexanoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 110206737 |
| Molecular Formula | C33H43N3O8 |
| Molecular Weight | 609.72 g/mol |
| Exact Mass | 609.31 |
| IUPAC Name | 1-[6-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]hexanoyl]piperidine-4-carboxylic acid |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(NCCCCCC(=O)N3CCC(C(=O)O)CC3)c(=O)cc1[C@@H](NC(C)=O)CC2 |
| InChI | InChI=1S/C33H43N3O8/c1-20(37)35-25-11-9-22-18-28(42-2)31(43-3)32(44-4)30(22)23-10-12-26(27(38)19-24(23)25)34-15-7-5-6-8-29(39)36-16-13-21(14-17-36)33(40)41/h10,12,18-19,21,25H,5-9,11,13-17H2,1-4H3,(H,34,38)(H,35,37)(H,40,41)/t25-/m0/s1 |
| InChIKey | XTNCITYWZFVYPO-VWLOTQADSA-N |
| XLogP | 4.16 |
| TPSA | 143.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.72 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|