C37H46N4O6 — CID 162862275
N-[1,2,3-trimethoxy-9-oxo-10-[[6-oxo-6-(4-phenylpiperazin-1-yl)hexyl]amino]-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide (PubChem CID 162862275) has the molecular formula C37H46N4O6 and a molecular weight of 642.80 g/mol. Its IUPAC name is N-[1,2,3-trimethoxy-9-oxo-10-[[6-oxo-6-(4-phenylpiperazin-1-yl)hexyl]amino]-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide.
| Compound Name | N-[1,2,3-trimethoxy-9-oxo-10-[[6-oxo-6-(4-phenylpiperazin-1-yl)hexyl]amino]-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide |
|---|---|
| PubChem CID | 162862275 |
| Molecular Formula | C37H46N4O6 |
| Molecular Weight | 642.80 g/mol |
| Exact Mass | 642.34 |
| IUPAC Name | N-[1,2,3-trimethoxy-9-oxo-10-[[6-oxo-6-(4-phenylpiperazin-1-yl)hexyl]amino]-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(NCCCCCC(=O)N3CCN(c4ccccc4)CC3)c(=O)cc1C(NC(C)=O)CC2 |
| InChI | InChI=1S/C37H46N4O6/c1-25(42)39-30-16-14-26-23-33(45-2)36(46-3)37(47-4)35(26)28-15-17-31(32(43)24-29(28)30)38-18-10-6-9-13-34(44)41-21-19-40(20-22-41)27-11-7-5-8-12-27/h5,7-8,11-12,15,17,23-24,30H,6,9-10,13-14,16,18-22H2,1-4H3,(H,38,43)(H,39,42) |
| InChIKey | QODLLHDRSCLSBD-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 109.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.80 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|