C19H24N2O2 — CID 110211179
6-methyl-3-[[(3S)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]chromen-4-one (PubChem CID 110211179) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is 6-methyl-3-[[(3S)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]chromen-4-one.
| Compound Name | 6-methyl-3-[[(3S)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]chromen-4-one |
|---|---|
| PubChem CID | 110211179 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 6-methyl-3-[[(3S)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]chromen-4-one |
| SMILES | Cc1ccc2occ(CN3CC4CCCN4C[C@@H]3C)c(=O)c2c1 |
| InChI | InChI=1S/C19H24N2O2/c1-13-5-6-18-17(8-13)19(22)15(12-23-18)10-21-11-16-4-3-7-20(16)9-14(21)2/h5-6,8,12,14,16H,3-4,7,9-11H2,1-2H3/t14-,16?/m0/s1 |
| InChIKey | PVKHVPQESLXAED-LBAUFKAWSA-N |
| XLogP | 2.77 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |