C21H23N5O2 — CID 110211568
N-[(1S)-1-[7-(4-methoxyphenyl)-[1,2,4]triazolo[1,5-c]pyrimidin-2-yl]ethyl]cyclohex-3-ene-1-carboxamide (PubChem CID 110211568) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is N-[(1S)-1-[7-(4-methoxyphenyl)-[1,2,4]triazolo[1,5-c]pyrimidin-2-yl]ethyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | N-[(1S)-1-[7-(4-methoxyphenyl)-[1,2,4]triazolo[1,5-c]pyrimidin-2-yl]ethyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 110211568 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | N-[(1S)-1-[7-(4-methoxyphenyl)-[1,2,4]triazolo[1,5-c]pyrimidin-2-yl]ethyl]cyclohex-3-ene-1-carboxamide |
| SMILES | COc1ccc(-c2cc3nc([C@H](C)NC(=O)C4CC=CCC4)nn3cn2)cc1 |
| InChI | InChI=1S/C21H23N5O2/c1-14(23-21(27)16-6-4-3-5-7-16)20-24-19-12-18(22-13-26(19)25-20)15-8-10-17(28-2)11-9-15/h3-4,8-14,16H,5-7H2,1-2H3,(H,23,27)/t14-,16?/m0/s1 |
| InChIKey | SLECCSYFUVZYAH-LBAUFKAWSA-N |
| XLogP | 3.33 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|