C24H31N3O4 — CID 110212070
1'-[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-oxoethyl]spiro[3H-1,3-benzoxazine-2,5'-azepane]-2',4-dione (PubChem CID 110212070) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is 1'-[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-oxoethyl]spiro[3H-1,3-benzoxazine-2,5'-azepane]-2',4-dione.
| Compound Name | 1'-[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-oxoethyl]spiro[3H-1,3-benzoxazine-2,5'-azepane]-2',4-dione |
|---|---|
| PubChem CID | 110212070 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | 1'-[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-oxoethyl]spiro[3H-1,3-benzoxazine-2,5'-azepane]-2',4-dione |
| SMILES | O=C1NC2(CCC(=O)N(CC(=O)N3CCCC4CCCCC43)CC2)Oc2ccccc21 |
| InChI | InChI=1S/C24H31N3O4/c28-21-11-12-24(25-23(30)18-8-2-4-10-20(18)31-24)13-15-26(21)16-22(29)27-14-5-7-17-6-1-3-9-19(17)27/h2,4,8,10,17,19H,1,3,5-7,9,11-16H2,(H,25,30) |
| InChIKey | HMLFFJCMODNTTG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |