C23H31N3O3 — CID 51494577
1'-[2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl]spiro[3H-1,3-benzoxazine-2,4'-piperidine]-4-one (PubChem CID 51494577) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is 1'-[2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl]spiro[3H-1,3-benzoxazine-2,4'-piperidine]-4-one.
| Compound Name | 1'-[2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl]spiro[3H-1,3-benzoxazine-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 51494577 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | 1'-[2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl]spiro[3H-1,3-benzoxazine-2,4'-piperidine]-4-one |
| SMILES | O=C1NC2(CCN(CC(=O)N3CCC[C@@H]4CCCC[C@@H]43)CC2)Oc2ccccc21 |
| InChI | InChI=1S/C23H31N3O3/c27-21(26-13-5-7-17-6-1-3-9-19(17)26)16-25-14-11-23(12-15-25)24-22(28)18-8-2-4-10-20(18)29-23/h2,4,8,10,17,19H,1,3,5-7,9,11-16H2,(H,24,28)/t17-,19-/m0/s1 |
| InChIKey | LQVWFXMHUDNVNB-HKUYNNGSSA-N |
| XLogP | 2.78 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |