C22H28N4O4 — CID 110212085
1'-[2-oxo-2-(4-prop-2-enylpiperazin-1-yl)ethyl]spiro[3H-1,3-benzoxazine-2,5'-azepane]-2',4-dione (PubChem CID 110212085) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is 1'-[2-oxo-2-(4-prop-2-enylpiperazin-1-yl)ethyl]spiro[3H-1,3-benzoxazine-2,5'-azepane]-2',4-dione.
| Compound Name | 1'-[2-oxo-2-(4-prop-2-enylpiperazin-1-yl)ethyl]spiro[3H-1,3-benzoxazine-2,5'-azepane]-2',4-dione |
|---|---|
| PubChem CID | 110212085 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 1'-[2-oxo-2-(4-prop-2-enylpiperazin-1-yl)ethyl]spiro[3H-1,3-benzoxazine-2,5'-azepane]-2',4-dione |
| SMILES | C=CCN1CCN(C(=O)CN2CCC3(CCC2=O)NC(=O)c2ccccc2O3)CC1 |
| InChI | InChI=1S/C22H28N4O4/c1-2-10-24-12-14-25(15-13-24)20(28)16-26-11-9-22(8-7-19(26)27)23-21(29)17-5-3-4-6-18(17)30-22/h2-6H,1,7-16H2,(H,23,29) |
| InChIKey | PQIHQPBZJNITOD-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|